CAS 28578-16-7

ethyl 3-(1,3-benzodioxol-5-yl)-2-methyloxirane-2-carboxylate

Description:

Ethyl 3-(1,3-benzodioxol-5-yl)-2-methyloxirane-2-carboxylate, with the CAS number 28578-16-7, is an organic compound characterized by its unique structure that includes an epoxide group and a benzodioxole moiety. This compound typically exhibits a moderate level of polarity due to the presence of both ester and epoxide functional groups, which can influence its solubility in various solvents. The benzodioxole ring contributes to its potential biological activity, as such structures are often associated with pharmacological properties. The compound may be synthesized through specific organic reactions involving the appropriate precursors, and it is likely to undergo typical reactions of epoxides, such as ring-opening under acidic or basic conditions. Its applications could span fields such as medicinal chemistry, where it may serve as an intermediate in the synthesis of more complex molecules or as a potential bioactive agent. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₃H₁₄O₅

InChI: InChI=1/C13H14O5/c1-3-15-12(14)13(2)11(18-13)8-4-5-9-10(6-8)17-7-16-9/h4-6,11H,3,7H2,1-2H3

SMILES: CCOC(=O)C1(C)C(c2ccc3c(c2)OCO3)O1

NSC 195099

Controlled Product

CAS: 28578-16-7

NSC 195099 is a research tool that belongs to the group of ligands. It has been shown to activate receptors and ion channels. NSC 195099 has also been shown to inhibit various peptides.

Formula: C₁₃H₁₄O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 250.25 g/mol

Ref: 3D-DBA57816

2-Oxiranecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-2-methyl-, ethyl ester

Controlled Product

CAS: 28578-16-7

Formula: C₁₃H₁₄O₅

Molecular weight: 250.2473

Ref: IN-DA002VR6