CAS 2858-20-0

4-Amino-2-chloro-6,7-dimethylpyrimidine

Description:

4-Amino-2-chloro-6,7-dimethylpyrimidine is an organic compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing nitrogen atoms. This compound features an amino group (-NH2) and a chloro group (-Cl) at specific positions on the pyrimidine ring, along with two methyl groups (-CH3) at the 6 and 7 positions. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, particularly as a building block in the synthesis of various biologically active compounds. The presence of the amino group enhances its reactivity, making it suitable for further chemical modifications. Additionally, the chlorine atom can influence the compound's solubility and stability. 4-Amino-2-chloro-6,7-dimethylpyrimidine is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups present. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₆H₈ClN₃

InChI: InChI=1/C6H8ClN3/c1-3-5(7)6(8)10-4(2)9-3/h1-2H3,(H2,8,9,10)

SMILES: Cc1c(c(=N)[nH]c(C)n1)Cl

Synonyms:

• 5-Chloro-2,6-Dimethylpyrimidin-4-Amine

4-Pyrimidinamine, 5-chloro-2,6-dimethyl-

CAS: 2858-20-0

Formula: C₆H₈ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 157.6008

Ref: IN-DA002VRA

5-Chloro-2,6-dimethylpyrimidin-4-amine

CAS: 2858-20-0

5-Chloro-2,6-dimethylpyrimidin-4-amine

Purity: 99%

Molecular weight: 157.60g/mol

Ref: 54-OR96093

4-Amino-5-chloro-2,6-dimethylpyrimidine

CAS: 2858-20-0

Formula: C₆H₈ClN₃

Purity: >98.0%(GC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 157.60

Ref: 3B-A1901

4-Amino-5-chloro-2,6-dimethylpyrimidine

CAS: 2858-20-0

4-Amino-5-chloro-2,6-dimethylpyrimidine is a supramolecular complex that is characterized by the coordination geometry of its metal ion and the donor atoms. It has been proposed as a potential drug for the treatment of bacterial infections, such as tuberculosis. The 4-Amino-5-chloro-2,6,dimethylpyrimidine is structurally similar to nucleobases and may be able to form hydrogen bonds with water molecules. This molecule also has a high melting point and is not soluble in water. It can be protonated at different pH values and forms complexes with hydroxyl groups found in nucleic acids.

Formula: C₆H₈ClN₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 157.6 g/mol

Ref: 3D-NA67922

5-Chloro-2,6-dimethylpyrimidin-4-amine

CAS: 2858-20-0

Purity: 95%

Molecular weight: 157.6000061

Ref: 10-F620527