
CAS 2858-66-4
:1-(2R)-2-Piperidinyl-2-propanone
Description:
1-(2R)-2-Piperidinyl-2-propanone, also known as 2-Piperidinone, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a ketone functional group, specifically a carbonyl group (C=O) adjacent to the piperidine moiety. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the piperidine ring contributes to its basicity and potential for forming hydrogen bonds, which can influence its solubility in various solvents. This compound is of interest in medicinal chemistry and can serve as a precursor in the synthesis of various pharmaceuticals and biologically active compounds. Its chiral center at the 2-position of the piperidine ring allows for the existence of enantiomers, which can exhibit different biological activities. Safety data indicates that it should be handled with care, as with many organic compounds, due to potential health hazards associated with exposure.
Formula:C8H15NO
InChI:InChI=1S/C8H15NO/c1-7(10)6-8-4-2-3-5-9-8/h8-9H,2-6H2,1H3/t8-/m1/s1
InChI key:InChIKey=JEIZLWNUBXHADF-MRVPVSSYSA-N
SMILES:C(C(C)=O)[C@H]1CCCCN1
Synonyms:- 1-(2R)-2-Piperidinyl-2-propanone
- (R)-(-)-Pelletierine
- 2-Propanone, 1-(2-piperidinyl)-, (R)-
- 2-Propanone, 1-(2R)-2-piperidinyl-
- Pelletierine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Pelletierine
CAS:Pelletierine is a natural product that can be used as a reference standard.Formula:C8H15NOColor and Shape:SolidMolecular weight:141.214

