CAS 285978-07-6
:beta-alanine-13C3-15N
Description:
Beta-alanine-13C3-15N, with the CAS number 285978-07-6, is a stable isotopically labeled form of beta-alanine, an amino acid that plays a crucial role in various biochemical processes. This compound features three carbon atoms that are isotopically enriched with carbon-13 (13C) and one nitrogen atom enriched with nitrogen-15 (15N), making it useful in metabolic studies and tracer experiments. Beta-alanine itself is a non-essential amino acid that is involved in the synthesis of carnosine, a dipeptide that acts as a buffer in muscle tissues, helping to regulate pH during high-intensity exercise. The incorporation of stable isotopes allows researchers to track the metabolic pathways and kinetics of beta-alanine in biological systems without the complications associated with radioactive isotopes. This compound is typically used in research settings, particularly in studies related to metabolism, nutrition, and exercise physiology. Its unique isotopic labeling enhances the understanding of amino acid metabolism and its physiological implications.
Formula:C3H715NO2
InChI:InChI=1/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)/i1+1,2+1,3+1,4+1
Synonyms:- β-(13C3,15N)alanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
β-Alanine-13C3,15N
CAS:Controlled ProductApplications β-Alanine-13C3,15N is the isotope labeled analogue of β-Alanine (A637320), which is a naturally occurring beta amino acid. β-Alanine is formed in vivo by the degradation of Dihydro Uracil (D449990) and Carnosine. β-Alanine is also the rate-limiting precursor of Carnosine, as a result supplementation with β-Alanine increases the concentration of Carnosine in muscles.
References Derave, W. et al.: J. Appl. Physiol., 103, 1736 (2007); Xia, J.-F. et al.: J. Chrom. B Anal. Technol. Biomed. Life Sci., 977, 1930 (2009); Artioli, G.G. et al.: Med. Sci. Sports Exer.,42, 1162 (2010);Formula:C3H715NO2Color and Shape:NeatMolecular weight:93.06

