CAS 286-85-1
:1H-cyclopropa[b]naphthalene
Description:
1H-cyclopropa[b]naphthalene, with the CAS number 286-85-1, is a polycyclic aromatic hydrocarbon characterized by its unique structure, which consists of a naphthalene core fused with a cyclopropane ring. This compound exhibits a planar configuration, contributing to its stability and potential for π-π stacking interactions. It is typically a colorless to pale yellow solid at room temperature and is insoluble in water but soluble in organic solvents. The presence of the cyclopropane moiety introduces angle strain, which can influence its reactivity and stability compared to other naphthalene derivatives. 1H-cyclopropa[b]naphthalene is of interest in organic chemistry and materials science due to its unique electronic properties and potential applications in organic electronics and photonics. Additionally, its structural features may provide insights into the behavior of similar polycyclic compounds in various chemical reactions and interactions. Safety data indicates that, like many polycyclic aromatic hydrocarbons, it should be handled with care due to potential health risks associated with exposure.
Formula:C11H8
InChI:InChI=1/C11H8/c1-2-4-9-6-11-7-10(11)5-8(9)3-1/h1-6H,7H2
Synonyms:- 1H-Cyclopropa[b]naphthalene
- 1H-Cyclopropa(b)naphthalene
- 2,3-Methanonaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
