CAS 28613-33-4
:Fumarylacetoacetic acid
Description:
Fumarylacetoacetic acid (FAA) is an organic compound characterized by its role as an intermediate in the metabolic pathway of the amino acid tyrosine. It is a dicarboxylic acid derivative, featuring both a fumarate and an acetoacetate moiety in its structure. FAA is typically a white to pale yellow crystalline solid, soluble in water and various organic solvents, which facilitates its use in biochemical applications. The compound is significant in the context of certain metabolic disorders, particularly tyrosinemia type I, where its accumulation can lead to toxic effects. FAA is also involved in the synthesis of various pharmaceuticals and can serve as a precursor in the production of other chemical compounds. Its reactivity is influenced by the presence of both carboxylic acid groups and the double bond in the fumarate structure, allowing for various chemical transformations. Safety considerations should be taken into account when handling FAA, as it may pose health risks if ingested or improperly managed.
Formula:C8H8O6
InChI:InChI=1S/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1+
InChI key:InChIKey=GACSIVHAIFQKTC-OWOJBTEDSA-N
SMILES:C(CC(/C=C/C(O)=O)=O)(CC(O)=O)=O
Synonyms:- (2E)-4,6-Dioxo-2-octendis?ure
- (2E)-4,6-Dioxo-2-octenedioic acid
- (E)-4,6-dioxo-2-Octenedioic acid
- 2-Octenedioic acid, 4,6-dioxo-, (E)-
- 2-octenedioic acid, 4,6-dioxo-, (2E)-
- 5698-52-2
- Fumarylacetoacetic acid
- NotAvailable
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-T-144004
Discontinued product
