CAS 28616-93-5
:5-bromo-2',3'-dideoxyuridine
Description:
5-Bromo-2',3'-dideoxyuridine (often abbreviated as BrdU) is a synthetic nucleoside analog of thymidine, characterized by the presence of a bromine atom at the 5-position of the uracil base and the absence of hydroxyl groups at the 2' and 3' positions of the sugar moiety. This modification renders BrdU resistant to further phosphorylation, making it a useful tool in molecular biology, particularly in studies of DNA synthesis and cell proliferation. BrdU can be incorporated into newly synthesized DNA in place of thymidine, allowing researchers to track cell division and DNA replication through various detection methods, such as immunohistochemistry. The compound exhibits low toxicity, making it suitable for in vivo studies. Additionally, BrdU has been utilized in cancer research and neurobiology to label dividing cells. Its chemical structure contributes to its unique properties, including its ability to form stable complexes with DNA polymerases, influencing the fidelity of DNA replication. Overall, BrdU serves as a valuable reagent in both basic and applied biological research.
Formula:C9H11BrN2O4
InChI:InChI=1/C9H11BrN2O4/c10-6-3-12(9(15)11-8(6)14)7-2-1-5(4-13)16-7/h3,5,7,13H,1-2,4H2,(H,11,14,15)/t5-,7+/m0/s1
Synonyms:- Uridine, 5-bromo-2',3'-dideoxy-
- 5-bromo-1-[5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidine-2,4(1H,3H)-dione
- 5-bromo-1-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidine-2,4(1H,3H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Bromo-2',3'-dideoxyuridine
CAS:<p>5-Bromo-2',3'-dideoxyuridine is a nucleoside analogue that is used as a chemotherapeutic drug against various types of cancer. It has been shown to have anti-tumour activity by interfering with the synthesis of deoxyribonucleic acid (DNA) and ribonucleic acid (RNA). 5-Bromo-2',3'-dideoxyuridine binds to the sugar ring in DNA and inhibits the enzyme DNA polymerase from synthesizing DNA. This drug also stabilizes conformations of the molecule, which are responsible for its pharmacological effects.<br>5-Bromo-2',3'-dideoxyuridine can be found in two different crystal structures, monoclinic and tetragonal. The monoclinic form is stabilized by hydrogen bonds between the puckers in the sugar ring and hydrogen bonds to neighboring molecules. This form is more soluble than the tetragonal form,</p>Purity:Min. 95%


