
CAS 2862-16-0
:7-Deazainosine
Description:
7-Deazainosine, with the CAS number 2862-16-0, is a purine nucleoside analog characterized by the presence of a 7-deaza modification in its structure. This compound consists of a ribose sugar linked to a modified adenine base, where the nitrogen atom at the 7-position of the purine ring is replaced by a carbon atom. This alteration affects its biological properties, making it a subject of interest in biochemical research, particularly in the study of nucleic acid metabolism and enzyme interactions. 7-Deazainosine is known to exhibit antiviral and anticancer activities, as it can interfere with nucleic acid synthesis. Its solubility in water and stability under physiological conditions make it a useful tool in various biochemical assays. Additionally, it can serve as a substrate for certain enzymes, allowing researchers to explore its role in cellular processes. Overall, 7-Deazainosine is a significant compound in the field of medicinal chemistry and molecular biology.
Formula:C11H13N3O5
InChI:InChI=1S/C11H13N3O5/c15-3-6-7(16)8(17)11(19-6)14-2-1-5-9(14)12-4-13-10(5)18/h1-2,4,6-8,11,15-17H,3H2,(H,12,13,18)/t6-,7-,8-,11-/m1/s1
InChI key:InChIKey=DPRSKJHWKNHBOW-KCGFPETGSA-N
SMILES:O[C@H]1[C@H](N2C3=C(C=C2)C(=O)N=CN3)O[C@H](CO)[C@H]1O
Synonyms:- 4H-Pyrrolo[2,3-d]pyrimidin-4-one, 3,7-dihydro-7-β-D-ribofuranosyl-
- 3,7-Dihydro-7-β-D-ribofuranosyl-4H-pyrrolo[2,3-d]pyrimidin-4-one
- 7-Deazainosine
- 7-(β-D-Ribofuranosyl)pyrrolo[2,3-d]pyrimidin-4-one
- 4H-Pyrrolo[2,3-d]pyrimidin-4-one, 1,7-dihydro-7-β-D-ribofuranosyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Deazainosine
CAS:7-Deazainosine is a biochemical.Formula:C11H13N3O5Color and Shape:SolidMolecular weight:267.24
