CAS 28623-57-6
:b-D-Glucopyranosiduronic acid,2-hydroxyphenyl
Description:
β-D-Glucopyranosiduronic acid, 2-hydroxyphenyl, with the CAS number 28623-57-6, is a chemical compound that features a glucopyranosiduronic acid structure, which is a derivative of glucose. This compound is characterized by the presence of a uronic acid group, which contributes to its acidic properties and potential reactivity. The 2-hydroxyphenyl moiety indicates the presence of a phenolic group, which can impart antioxidant properties and influence the compound's solubility and interaction with biological systems. Typically, compounds like this can participate in various biochemical processes, including those related to plant metabolism and the synthesis of polysaccharides. The presence of hydroxyl groups enhances hydrogen bonding capabilities, affecting its physical properties such as solubility in water and organic solvents. Additionally, the structural features suggest potential applications in pharmaceuticals, biochemistry, and materials science, particularly in the development of glycosylated compounds or as intermediates in organic synthesis.
Formula:C12H14O8
InChI:InChI=1S/C12H14O8/c13-5-3-1-2-4-6(5)19-12-9(16)7(14)8(15)10(20-12)11(17)18/h1-4,7-10,12-16H,(H,17,18)/t7-,8-,9+,10-,12+/m0/s1
InChI key:InChIKey=ICPYZFZFSLTYID-GOVZDWNOSA-N
SMILES:O([C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O)C2=C(O)C=CC=C2
Synonyms:- 2-Hydroxyphenyl β-<span class="text-smallcaps">D</span>-glucopyranosiduronic acid
- Glucopyranosiduronic acid, o-hydroxyphenyl, β-<span class="text-smallcaps">D</span>-
- Glucopyranosiduronicacid, o-hydroxyphenyl, b-D- (8CI)
- Pyrocatechol glucuronide
- β-<span class="text-smallcaps">D</span>-Glucopyranosiduronic acid, 2-hydroxyphenyl
- 2-Hydroxyphenyl β-D-glucopyranosiduronic acid
- β-D-Glucopyranosiduronic acid, 2-hydroxyphenyl
- Glucopyranosiduronic acid, o-hydroxyphenyl, β-D-
- catechol beta-D-glucuronide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Catechol-β-D-Glucuronide
CAS:Formula:C12H14O8Color and Shape:Pale Yellow SolidMolecular weight:286.24
