CAS 28624-28-4
:(+)-δ-Selinene
Description:
(+)-δ-Selinene is a naturally occurring sesquiterpene, characterized by its complex bicyclic structure. It is primarily found in various essential oils, particularly those derived from plants in the Apiaceae family, such as carrots and celery. This compound is known for its distinctive aroma, often described as earthy or woody, which contributes to its use in perfumery and flavoring. Chemically, (+)-δ-Selinene exhibits a molecular formula that reflects its sesquiterpene classification, typically consisting of 15 carbon atoms and 24 hydrogen atoms. The compound is optically active, with a specific rotation that indicates its chirality. Its stability and reactivity can be influenced by environmental factors such as temperature and light. In addition to its sensory properties, (+)-δ-Selinene has been studied for potential biological activities, including antimicrobial and anti-inflammatory effects, making it of interest in both food science and pharmacology. Overall, (+)-δ-Selinene represents a significant compound in natural product chemistry, with diverse applications in various industries.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h10-11H,5-9H2,1-4H3/t15-/m1/s1
InChI key:InChIKey=VEGYMPQCXPVQJY-OAHLLOKOSA-N
SMILES:C[C@]12C(C=C(C(C)C)CC1)=C(C)CCC2
Synonyms:- Naphthalene, 2,3,4,4a,5,6-hexahydro-1,4a-dimethyl-7-(1-methylethyl)-, (R)-
- δ-Selinene, (+)-
- Naphthalene, 2,3,4,4a,5,6-hexahydro-1,4a-dimethyl-7-(1-methylethyl)-, (4aR)-
- (4aR)-2,3,4,4a,5,6-Hexahydro-1,4a-dimethyl-7-(1-methylethyl)naphthalene
- Eudesma-4,6-diene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
