
CAS 28638-13-3
:Quercetin 3,7-dirhamnoside
Description:
Quercetin 3,7-dirhamnoside, also known as quercetin-3,7-diglycoside, is a flavonoid glycoside characterized by its structure, which consists of the flavonoid quercetin bound to two rhamnose sugar units. This compound is typically found in various plants, particularly in fruits, vegetables, and herbs, contributing to their antioxidant properties. Quercetin 3,7-dirhamnoside exhibits several biological activities, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in nutritional and pharmaceutical research. Its solubility is generally higher in polar solvents, and it may exhibit varying degrees of stability depending on environmental conditions such as pH and temperature. The compound is often studied for its health benefits, particularly in relation to cardiovascular health and immune function. Additionally, its presence in dietary sources highlights its importance in human nutrition and potential therapeutic applications. As with many flavonoids, the bioavailability and metabolism of quercetin 3,7-dirhamnoside can be influenced by dietary factors and individual physiological conditions.
Formula:C27H30O15
InChI:InChI=1S/C27H30O15/c1-8-17(31)20(34)22(36)26(38-8)40-11-6-14(30)16-15(7-11)41-24(10-3-4-12(28)13(29)5-10)25(19(16)33)42-27-23(37)21(35)18(32)9(2)39-27/h3-9,17-18,20-23,26-32,34-37H,1-2H3/t8-,9-,17-,18-,20+,21+,22+,23+,26-,27-/m0/s1
InChI key:InChIKey=GXLQUHPXGLZNGE-BJBZVNFPSA-N
SMILES:O(C1=C(OC=2C(C1=O)=C(O)C=C(O[C@H]3[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O3)C2)C4=CC(O)=C(O)C=C4)[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5
Synonyms:- Quercetin 3,7-dirhamnoside
- Flavone, 3,3′,4′,5,7-pentahydroxy-, 3,7-bis(6-deoxy-α-L-mannopyranoside)
- 3,7-Bis[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3,7-bis[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-
- Quercetin 3,7-di-α-L-rhamnoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4H-1-Benzopyran-4-one, 3,7-bis[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-
CAS:Formula:C27H30O15Purity:powderColor and Shape:SolidMolecular weight:594.5181Quercetin 3,7-di-O-rhamnoside
CAS:<p>Quercetin 3,7-di-O-rhamnoside is a natural product for research related to life sciences. The catalog number is TN6193 and the CAS number is 28638-13-3.</p>Formula:C27H30O15Purity:98%Color and Shape:SolidMolecular weight:594.522Quercetin 3,7-di-o-rhamnoside
CAS:<p>Quercetin 3,7-di-o-rhamnoside is a bioflavonoid glycoside, which is a naturally occurring compound found in various plants. This glycoside is derived primarily from the rhamnose sugars attached to the hydroxyl groups at the 3 and 7 positions of the quercetin molecule. Its mode of action involves scavenging free radicals and modulating signaling pathways to exert antioxidant and anti-inflammatory effects. This compound can inhibit key enzymes in inflammation pathways and has been shown to interfere with the oxidative stress response, contributing to its overall protective action on cellular systems.</p>Formula:C27H30O15Purity:Min. 95%Molecular weight:594.5 g/mol


