CAS 286425-42-1
:dl-phenylalanine-beta-13C
Description:
dl-Phenylalanine-beta-13C, with the CAS number 286425-42-1, is a stable isotope-labeled form of the amino acid phenylalanine, which is essential for protein synthesis and serves as a precursor for neurotransmitters. This compound is characterized by the incorporation of the carbon-13 isotope at the beta position of the phenylalanine molecule, allowing for its use in various research applications, particularly in metabolic studies and tracer experiments. The presence of the carbon-13 isotope enables researchers to track the metabolic pathways and interactions of phenylalanine in biological systems using techniques such as nuclear magnetic resonance (NMR) spectroscopy. As a non-toxic and naturally occurring amino acid, dl-phenylalanine-beta-13C is generally regarded as safe for use in laboratory settings. Its unique isotopic labeling provides valuable insights into amino acid metabolism, protein dynamics, and the biochemical roles of phenylalanine in health and disease.
Formula:C813CH11NO2
InChI:InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i6+1
Synonyms:- 2-Amino-3-Phenyl-Propanoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
DL-Phenylalanine-3-13C
CAS:Controlled Product<p>Applications DL-Phenylalanine-3-13C (CAS# 286425-42-1) is a useful isotopically labeled research compound.<br></p>Formula:C8C)H11NO2Color and Shape:NeatMolecular weight:166.18
