CAS 286426-31-1

(αS)-3-Hydroxy-α-[[methyl(phenylmethyl)amino]methyl]benzenemethanol

Description:

(αS)-3-Hydroxy-α-[[methyl(phenylmethyl)amino]methyl]benzenemethanol, with the CAS number 286426-31-1, is a chemical compound characterized by its complex structure, which includes a hydroxyl group and an amino group attached to a benzene ring. This compound is likely to exhibit properties typical of secondary amines and alcohols, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of both a hydroxyl group and an amino group suggests potential for biological activity, possibly interacting with various biological targets. Its stereochemistry, indicated by the (αS) designation, implies specific spatial arrangements that can affect its reactivity and interaction with biological systems. Additionally, the presence of a phenylmethyl group may enhance lipophilicity, potentially influencing its pharmacokinetic properties. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry or as a research tool in biochemical studies.

Formula: C₁₆H₁₉NO₂

InChI: InChI=1S/C16H19NO2/c1-17(11-13-6-3-2-4-7-13)12-16(19)14-8-5-9-15(18)10-14/h2-10,16,18-19H,11-12H2,1H3/t16-/m1/s1

InChI key: InChIKey=JBBZPOHBHNEKIM-MRXNPFEDSA-N

SMILES: [C@H](CN(CC1=CC=CC=C1)C)(O)C2=CC(O)=CC=C2

Synonyms:

• Benzenemethanol, 3-hydroxy-α-[[methyl(phenylmethyl)amino]methyl]-, (αS)-
• (αS)-3-Hydroxy-α-[[methyl(phenylmethyl)amino]methyl]benzenemethanol

Phenylephrine EP Impurity D ((S)-Isomer)

CAS: 286426-31-1

Formula: C₁₆H₁₉NO₂

Color and Shape: White To Off-White Solid

Molecular weight: 257.34

Ref: 4Z-P-2611