CAS 28659-87-2

(2S)-2-bromo-4-methylpentanoic acid

Description:

(2S)-2-bromo-4-methylpentanoic acid is an organic compound characterized by its chiral center at the second carbon, which is denoted by the (2S) configuration. This compound features a bromine atom attached to the second carbon of a five-carbon chain, along with a carboxylic acid functional group (-COOH) at the end of the chain. The presence of the methyl group at the fourth carbon adds to its complexity and influences its physical and chemical properties. As a bromo acid, it exhibits both acidic behavior due to the carboxylic group and potential reactivity associated with the bromine atom, making it useful in various synthetic applications. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. Its solubility in water is moderate, influenced by the hydrophilic carboxylic acid group. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and esterifications, making it a valuable intermediate in organic synthesis and pharmaceutical development.

Formula: C₆H₁₁BrO₂

InChI: InChI=1/C6H11BrO2/c1-4(2)3-5(7)6(8)9/h4-5H,3H2,1-2H3,(H,8,9)/t5-/m0/s1

SMILES: CC(C)C[C@@H](C(=O)O)Br

S-2--Bromo -4-methylvaleric acid

CAS: 28659-87-2

Formula: C₆H₁₁BrO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 195.0543

Ref: IN-DA00C1MR

(S)-2-Bromo-4-methylpentanoic acid

CAS: 28659-87-2

(S)-2-Bromo-4-methylpentanoic acid

Purity: 95%

Molecular weight: 195.05g/mol

Ref: 54-OR90690

(S)-2-Bromo-4-methylpentanoic acid

CAS: 28659-87-2

Formula: C₆H₁₁BrO₂

Purity: 95%

Color and Shape: No data available.

Molecular weight: 195.056

Ref: 10-F054395

(S)-2-Bromo-4-methylpentanoic acid ee

CAS: 28659-87-2

(S)-2-Bromo-4-methylpentanoic acid ee is a peptidomimetic that has been synthesized using triphosgene and a chiral amide. This compound is a synthetic molecule that contains a nitrogen atom. The (S) enantiomer of this compound was synthesized by nature and the structure of this compound is structured, with sulfur atoms on the side chains. This chiral molecule has been shown to have antibacterial activity against leucocytes, which may be due to its conformational effects.

Formula: C₆H₁₁BrO₂

Purity: Min. 95%

Molecular weight: 195.05 g/mol

Ref: 3D-DBA65987