CAS 28682-94-2

5,6-dihydro-4H-imidazo[4,5-d]pyridazin-4-one

Description:

5,6-Dihydro-4H-imidazo[4,5-d]pyridazin-4-one is a heterocyclic organic compound characterized by its fused imidazole and pyridazine rings. This compound features a bicyclic structure that contributes to its unique chemical properties. It typically exhibits a solid state at room temperature and is soluble in polar organic solvents. The presence of nitrogen atoms in the ring structure can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound may also exhibit biological activity, which has led to interest in its potential applications in pharmaceuticals and agrochemicals. Its molecular structure allows for various functionalizations, which can enhance its properties for specific applications. As with many heterocycles, the stability and reactivity of 5,6-dihydro-4H-imidazo[4,5-d]pyridazin-4-one can be influenced by substituents on the ring, making it a versatile compound in synthetic chemistry.

Formula: C₅H₄N₄O

InChI: InChI=1/C5H4N4O/c10-5-4-3(1-8-9-5)6-2-7-4/h1-2,8H,(H,9,10)

1H-Imidazo[4,5-d]pyridazin-7(6H)-one

CAS: 28682-94-2

Formula: C₅H₄N₄O

Molecular weight: 136.1115

Ref: IN-DA002W2F

1H,4H,5H-Imidazo[4,5-d]pyridazin-4-one

CAS: 28682-94-2

1H,4H,5H-Imidazo[4,5-d]pyridazin-4-one is a tautomeric form of guanine. It can be synthesized from 1H,4H,5H-imidazo[4,5-d]pyridazine and purine. This experimental compound is an analog to adenine and has been shown to have anti-parasitic properties in toxoplasma. 1H,4H,5H-Imidazo[4,5-d]pyridazin-4-one is a nucleobase that binds to the purine receptor on the parasite's surface. This binding inhibits the parasite's ability to produce ATP by inhibiting adenosine phosphorylation.

Formula: C₅H₄N₄O

Purity: Min. 95%

Molecular weight: 136.11 g/mol

Ref: 3D-DBA68294