CAS 2869-83-2
:Janus Green B
Description:
Janus Green B is a synthetic dye belonging to the class of triphenylmethane dyes, characterized by its vibrant blue-green color. It is commonly used as a biological stain, particularly in histology and microbiology, due to its ability to selectively stain living cells and certain cellular components. The dye exhibits a cationic nature, allowing it to bind to negatively charged cellular structures, such as nucleic acids and phospholipids. Janus Green B is soluble in water and exhibits a distinct absorption spectrum, making it useful for various analytical applications. In addition to its staining properties, it has been studied for its potential role in photodynamic therapy and as a redox indicator. However, caution is advised when handling Janus Green B, as it may pose health risks, including potential toxicity and environmental concerns. Overall, its unique properties make it a valuable tool in both research and clinical settings.
Formula:C30H31N6·Cl
InChI:InChI=1S/C30H31N6.ClH/c1-5-35(6-2)26-17-19-28-30(21-26)36(25-10-8-7-9-11-25)29-20-23(14-18-27(29)31-28)33-32-22-12-15-24(16-13-22)34(3)4;/h7-21H,5-6H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=XXACTDWGHQXLGW-UHFFFAOYSA-M
SMILES:N(CC)(CC)C1=CC=2[N+](=C3C(=NC2C=C1)C=CC(N=NC4=CC=C(N(C)C)C=C4)=C3)C5=CC=CC=C5.[Cl-]
Synonyms:- 3-(diethylamino)-7-{(E)-[4-(dimethylamino)phenyl]diazenyl}-5-phenylphenazin-5-ium chloride
- 3-Diethylamino-7-(p-dimethylaminophenylazo)-5-phenylphenazinium chloride
- Janus Green V
- Phenazinium, 3-(diethylamino)-7-[2-[4-(dimethylamino)phenyl]diazenyl]-5-phenyl-, chloride (1:1)
- Phenazinium, 3-(diethylamino)-7-[[4-(dimethylamino)phenyl]azo]-5-phenyl-, chloride
- Phenazinium, 3-(diethylamino)-7-[[p-(dimethylamino)phenyl]azo]-5-phenyl-, chloride
- Union Green B
- Janus Green B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Janus Green B
CAS:Formula:C30H31ClN6Color and Shape:Dark green to Dark blue to Black powder to crystalMolecular weight:511.07Janus Green B
CAS:<p>Janus Green B is a stain that interacts with DNA and has been used for histology studies including mitochondrial staining, in which its oxidation and reduction reveals alterations to the electron transfer chain. The stain has been utilized in studies for effective and rapid staining of insect chordo</p>Formula:C30H31ClN6Color and Shape:Powder, Dark green or dark blue to blackMolecular weight:511.07Phenazinium, 3-(diethylamino)-7-[2-[4-(dimethylamino)phenyl]diazenyl]-5-phenyl-, chloride (1:1)
CAS:Formula:C30H31ClN6Purity:%Color and Shape:SolidMolecular weight:511.0603Janus Green B (C.I. 11050)
CAS:Formula:C30H31ClN6Purity:≥ 70.0%Color and Shape:Blue to black powderMolecular weight:511.07Janus green B
CAS:Janus green B is an agent of basic dye.Formula:C30H31ClN6Color and Shape:Green PowderMolecular weight:511.07Janus Green B (JG-B), 65%
CAS:Formula:C30H31ClN6Color and Shape:Dark brownish black, PowderMolecular weight:511.07








