CymitQuimica logo

CAS 28691-47-6

:

1,2-Benzisoxazole-3-carboxylic acid

Description:
1,2-Benzisoxazole-3-carboxylic acid is a heterocyclic organic compound characterized by its fused benzene and isoxazole rings, along with a carboxylic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its structure enables it to engage in hydrogen bonding, which can influence its solubility and reactivity. 1,2-Benzisoxazole-3-carboxylic acid is of interest in medicinal chemistry and material science due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Additionally, it serves as a building block in the synthesis of more complex organic molecules. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H5NO3
InChI:InChI=1S/C8H5NO3/c10-8(11)7-5-3-1-2-4-6(5)12-9-7/h1-4H,(H,10,11)
InChI key:InChIKey=VPYXATIIMHQAPR-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(ON1)=CC=CC2
Synonyms:
  • 1,2-Benzisoxazole-3-Carboxylic Acid
  • 1,2-Benzoxazole-3-carboxylic acid
  • 3-Benzo[d]isoxazolecarboxylic acid
  • 3-Carboxy-1,2-benzisoxazole
  • Benzo[d]isoxazole-3-carboxylicacid
  • Benzo[d]isoxazole-3-carboxylic acid
Found 4 products.