CAS 28691-49-8

6-chloro-1,2-benzoxazole-3-carboxylic acid

Description:

6-Chloro-1,2-benzoxazole-3-carboxylic acid is a heterocyclic organic compound characterized by the presence of a benzoxazole ring, which is a fused bicyclic structure containing both benzene and oxazole moieties. The compound features a chlorine atom at the 6-position of the benzoxazole ring and a carboxylic acid functional group at the 3-position, contributing to its acidic properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which can facilitate its use in various chemical reactions and applications. It may exhibit biological activity, making it of interest in pharmaceutical research and development. The presence of the chlorine substituent can influence its reactivity and interaction with biological targets. Additionally, the compound's structure suggests potential applications in materials science and organic synthesis, particularly in the development of agrochemicals or pharmaceuticals. As with many chemical substances, safety data should be consulted to understand its handling and toxicity profiles.

Formula: C₈H₄ClNO₃

InChI: InChI=1/C8H4ClNO3/c9-4-1-2-5-6(3-4)13-10-7(5)8(11)12/h1-3H,(H,11,12)

SMILES: c1cc2c(cc1Cl)onc2C(=O)O

Synonyms:

• 1,2-Benzisoxazole-3-carboxylic acid, 6-chloro-
• 6-Chloro-1,2-benzoxazole-3-carboxylic acid

1,2-Benzisoxazole-3-carboxylic acid, 6-chloro-

CAS: 28691-49-8

Formula: C₈H₄ClNO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 197.5753

Ref: IN-DA002W45

6-Chlorobenzo[d]isoxazole-3-carboxylic acid

CAS: 28691-49-8

6-Chlorobenzo[d]isoxazole-3-carboxylic acid

Purity: 98%

Molecular weight: 197.577g/mol

Ref: 54-OR75010

6-Chlorobenzo[d]isoxazole-3-carboxylic acid

CAS: 28691-49-8

Formula: C₈H₄ClNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 197.57

Ref: 10-F077587