CymitQuimica logo

CAS 286932-43-2

:

1,1,1,6,6,6-Hexafluoro-2-methyl-5-phenyl-3-hexyne-2,5-diol

Description:
1,1,1,6,6,6-Hexafluoro-2-methyl-5-phenyl-3-hexyne-2,5-diol is a specialized organic compound characterized by its unique structure, which includes multiple fluorine atoms and a complex hydrocarbon framework. The presence of six fluorine atoms contributes to its high stability and low reactivity, making it useful in various applications, particularly in the field of materials science and as a potential intermediate in organic synthesis. The compound features a diol functional group, indicating the presence of two hydroxyl (-OH) groups, which can participate in hydrogen bonding and influence its solubility and reactivity. Additionally, the phenyl group enhances its aromatic characteristics, potentially affecting its electronic properties. This compound is likely to be a colorless or pale liquid, with a relatively high boiling point due to the strong C-F bonds. Its specific applications may include use in pharmaceuticals, agrochemicals, or as a solvent in chemical reactions, although detailed safety and handling information should be consulted due to the presence of fluorinated components.
Formula:C13H10F6O2
InChI:InChI=1S/C13H10F6O2/c1-10(20,12(14,15)16)7-8-11(21,13(17,18)19)9-5-3-2-4-6-9/h2-6,20-21H,1H3
InChI key:InChIKey=CVXQUYAMFLGBFJ-UHFFFAOYSA-N
SMILES:C(C#CC(C(F)(F)F)(C)O)(C(F)(F)F)(O)C1=CC=CC=C1
Synonyms:
  • 1,1,1,6,6,6-Hexafluoro-2-methyl-5-phenyl-3-hexyne-2,5-diol
  • 3-Hexyne-2,5-diol, 1,1,1,6,6,6-hexafluoro-2-methyl-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.