CAS 286932-57-8
:2-bromo-1-fluoro-4-(trifluoromethoxy)benzene
Description:
2-Bromo-1-fluoro-4-(trifluoromethoxy)benzene is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, and a trifluoromethoxy group attached to a benzene ring. This compound features a complex substitution pattern that contributes to its unique chemical properties. The bromine and fluorine substituents can influence the compound's reactivity, making it potentially useful in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The trifluoromethoxy group enhances the electron-withdrawing characteristics of the molecule, which can affect its solubility and stability in different solvents. Additionally, the presence of multiple fluorine atoms typically increases the compound's lipophilicity and may impart unique biological activities. Due to its specific functional groups, 2-bromo-1-fluoro-4-(trifluoromethoxy)benzene may find applications in pharmaceuticals, agrochemicals, or materials science, where fluorinated compounds are often sought for their distinctive properties. Safety and handling considerations should be taken into account due to the presence of halogens, which can pose environmental and health risks.
Formula:C7H3BrF4O
InChI:InChI=1/C7H3BrF4O/c8-5-3-4(1-2-6(5)9)13-7(10,11)12/h1-3H
SMILES:c1cc(c(cc1OC(F)(F)F)Br)F
Synonyms:- 1-Bromo-2-fluoro-5-(trifluoromethoxy)benzene
- 3-Bromo-4-fluoro(trifluoromethoxy)benzene
- 3-Bromo-4-fluorophenyl trifluoromethyl ether
- Benzene, 2-Bromo-1-Fluoro-4-(Trifluoromethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-2-fluoro-5-(trifluoromethoxy)benzene, 98%
CAS:1-Bromo-2-fluoro-5-(trifluoromethoxy)benzene used as solvents. Mostly employed in chemical processing, extraction and separation of chemicals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer t
Formula:C7H3BrF4OPurity:98%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:259.00Benzene, 2-bromo-1-fluoro-4-(trifluoromethoxy)-
CAS:Formula:C7H3BrF4OPurity:97%Color and Shape:LiquidMolecular weight:258.99572-Bromo-1-fluoro-4-(trifluoromethoxy)benzene
CAS:2-Bromo-1-fluoro-4-(trifluoromethoxy)benzene
Formula:C7H3BrF4OPurity:97%Color and Shape: clear. colourless liquidMolecular weight:259.00g/mol2-Bromo-1-fluoro-4-(trifluoromethoxy)benzene
CAS:Formula:C7H3BrF4OPurity:97%Color and Shape:LiquidMolecular weight:258.998



