CAS 286947-03-3
:5-bromo-2-chloro-3-methoxypyridine
Description:
5-Bromo-2-chloro-3-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and chlorine substituents at the 5 and 2 positions, respectively, along with a methoxy group (-OCH3) at the 3 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar methoxy group. It is often used in medicinal chemistry and organic synthesis as an intermediate for the development of pharmaceuticals and agrochemicals. The halogen substituents can enhance reactivity, making it suitable for various coupling reactions or further functionalization. Additionally, the compound's structure may influence its biological activity, making it a subject of interest in research related to drug discovery and development. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C6H5BrClNO
InChI:InChI=1/C6H5BrClNO/c1-10-5-2-4(7)3-9-6(5)8/h2-3H,1H3
SMILES:COc1cc(cnc1Cl)Br
Synonyms:- 5-Brom-2-chlor-3-methoxypyridin
- Pyridine, 5-Bromo-2-Chloro-3-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pyridine, 5-bromo-2-chloro-3-methoxy-
CAS:Formula:C6H5BrClNOPurity:98%Color and Shape:SolidMolecular weight:222.4670Ref: IN-DA002W4C
1g46.00€5g98.00€10g155.00€1kgTo inquire25g218.00€500gTo inquire100mg20.00€250mg24.00€5-Bromo-2-chloro-3-methoxypyridine
CAS:<p>5-Bromo-2-chloro-3-methoxypyridine</p>Formula:C6H5BrClNOPurity:≥95%Color and Shape: white to off-white solidMolecular weight:222.47g/mol5-Bromo-2-chloro-3-methoxypyridine
CAS:Formula:C6H5BrClNOPurity:95%Color and Shape:Solid, White powderMolecular weight:222.475-Bromo-2-chloro-3-methoxypyridine
CAS:<p>5-Bromo-2-chloro-3-methoxypyridine is a kinase inhibitor that belongs to the class of compounds called analogues. This compound has been shown to be an efficient, selective and potent inhibitor of the csf1R protein kinase. 5-Bromo-2-chloro-3-methoxypyridine has also been shown to inhibit the activity of other kinases such as cdc2, cdk4, cdk6 and cdk7. The structure of this compound was used as a starting point in the development of a new class of kinase inhibitors.</p>Formula:C6H5BrClNOPurity:Min. 95%Color and Shape:SolidMolecular weight:222.47 g/molRef: 3D-FB42900
Discontinued product




