CAS 287172-67-2

Benzene, 1,1′-(tetrafluoro-1,2-ethanediyl)bis[3-(trifluoromethyl)-

Description:

Benzene, 1,1′-(tetrafluoro-1,2-ethanediyl)bis[3-(trifluoromethyl)-, identified by CAS number 287172-67-2, is a fluorinated organic compound characterized by its complex structure that includes a benzene ring and multiple fluorinated substituents. The presence of trifluoromethyl groups (-CF3) enhances its chemical stability and lipophilicity, making it useful in various applications, including as a potential intermediate in the synthesis of fluorinated materials. The tetrafluoro-1,2-ethanediyl moiety introduces significant electronegativity and alters the compound's reactivity compared to non-fluorinated analogs. This compound is likely to exhibit low volatility and high thermal stability due to the strong C-F bonds. Additionally, its unique properties may lead to applications in pharmaceuticals, agrochemicals, or as a specialty chemical in materials science. However, the environmental and health impacts of such fluorinated compounds are subjects of ongoing research, given the persistence of fluorinated substances in the environment.

Formula: C₁₆H₈F₁₀

InChI: InChI=1S/C16H8F10/c17-13(18,9-3-1-5-11(7-9)15(21,22)23)14(19,20)10-4-2-6-12(8-10)16(24,25)26/h1-8H

InChI key: InChIKey=FZXKHINLRQLJNU-UHFFFAOYSA-N

SMILES: C(C(F)(F)C1=CC(C(F)(F)F)=CC=C1)(F)(F)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 1,1'-(1,1,2,2-Tetrafluoroethane-1,2-Diyl)Bis[3-(Trifluoromethyl)Benzene]
• Benzene, 1,1′-(tetrafluoro-1,2-ethanediyl)bis[3-(trifluoromethyl)-

1,2-Bis[3-(trifluoromethyl)phenyl]-1,1,2,2-tetrafluoroethane

CAS: 287172-67-2

1,2-Bis[3-(trifluoromethyl)phenyl]-1,1,2,2-tetrafluoroethane

Purity: 97%

Molecular weight: 390.21875g/mol

Ref: 54-PC7397