CAS 287192-97-6

1-Boc-4-ethynylpiperidine

Description:

1-Boc-4-ethynylpiperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The "Boc" (tert-butoxycarbonyl) group serves as a protective group for the amine, enhancing the compound's stability and facilitating its use in organic synthesis. The presence of the ethynyl group introduces a triple bond, contributing to the compound's reactivity and potential applications in various chemical reactions, including cross-coupling and click chemistry. This compound is typically utilized in medicinal chemistry and drug development due to its structural features that may influence biological activity. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in pharmacology. Additionally, the compound's solubility and stability in organic solvents are important characteristics that influence its handling and application in laboratory settings. Overall, 1-Boc-4-ethynylpiperidine is a versatile intermediate in the synthesis of more complex molecules.

Formula: C₁₂H₁₉NO₂

InChI: InChI=1/C12H19NO2/c1-5-10-6-8-13(9-7-10)11(14)15-12(2,3)4/h1,10H,6-9H2,2-4H3

SMILES: C#CC1CCN(CC1)C(=O)OC(C)(C)C

Synonyms:

• tert-Butyl 4-ethynylpiperidine-1-carboxylate
• N-Boc-4-ethynylpiperidine

1-Piperidinecarboxylic acid, 4-ethynyl-, 1,1-dimethylethyl ester

CAS: 287192-97-6

Formula: C₁₂H₁₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 209.2848

Ref: IN-DA002W9G

1-Boc-4-ethynylpiperidine

CAS: 287192-97-6

1-Boc-4-ethynylpiperidine

Purity: 98%

Molecular weight: 209.29g/mol

Ref: 54-OR74512

1-Boc-4-Ethynylpiperidine

CAS: 287192-97-6

Formula: C₁₂H₁₉NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 209.289

Ref: 10-F079763