CymitQuimica logo

CAS 287193-01-5

:

3-Ethynyl-1-azetidinecarboxylic acid tert-butyl ester

Description:
3-Ethynyl-1-azetidinecarboxylic acid tert-butyl ester is a chemical compound characterized by its unique structure, which includes an azetidine ring and an ethynyl group. The presence of the tert-butyl ester functional group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. This compound is typically used in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals due to its potential biological activity. The azetidine ring contributes to its conformational rigidity, which can influence its reactivity and interaction with biological targets. Additionally, the ethynyl group can participate in further chemical reactions, such as cross-coupling or click chemistry, allowing for the construction of more complex molecular architectures. As with many chemical substances, handling should be done with care, following appropriate safety protocols, as it may exhibit specific hazards or reactivity under certain conditions.
Formula:C10H15NO2
InChI:InChI=1S/C10H15NO2/c1-5-8-6-11(7-8)9(12)13-10(2,3)4/h1,8H,6-7H2,2-4H3
InChI key:UENGYBYGCXKNRF-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC(C1)C#C
Synonyms:
  • Tert-Butyl 3-Ethynylazetidine-1-Carboxylate
Found 4 products.