CymitQuimica logo

CAS 287194-37-0

:

N-(2,5-Dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl)-2-hydroxybenzamide

Description:
N-(2,5-Dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl)-2-hydroxybenzamide is a chemical compound characterized by its complex bicyclic structure, which includes a dioxo group and an oxabicyclo framework. This compound features a hydroxyl group (-OH) attached to a benzamide moiety, contributing to its potential biological activity. The bicyclic system suggests that it may exhibit unique reactivity and stability due to the strain and electronic effects inherent in such structures. The presence of the dioxo groups indicates potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's specific stereochemistry and functional groups may influence its solubility, melting point, and overall reactivity. While detailed studies on its pharmacological properties may be limited, compounds with similar structural features often show promise in various applications, including as pharmaceuticals or agrochemicals. Further research would be necessary to fully elucidate its properties and potential uses.
Formula:C13H9NO5
InChI:InChI=1S/C13H9NO5/c15-8-4-2-1-3-6(8)13(18)14-7-5-9(16)11-12(19-11)10(7)17/h1-5,11-12,15H,(H,14,18)
InChI key:InChIKey=DJSICXICJKSEMB-UHFFFAOYSA-N
SMILES:O=C1C2C(O2)C(=O)C=C1NC(=O)C3=C(O)C=CC=C3
Synonyms:
  • N-(2,5-Dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl)-2-hydroxybenzamide
  • Benzamide, N-(2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl)-2-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.