CAS 2872-65-3
:4-methoxyphenyl 2,3,4,6-tetra-O-acetyl-beta-D-galactopyranoside
Description:
4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-beta-D-galactopyranoside, with the CAS number 2872-65-3, is a glycoside compound characterized by the presence of a galactopyranoside moiety that is fully acetylated at four hydroxyl positions. This compound features a methoxyphenyl group, which contributes to its aromatic properties and potential reactivity. The acetyl groups enhance the lipophilicity of the molecule, making it more soluble in organic solvents compared to its non-acetylated counterparts. It is typically used in organic synthesis and carbohydrate chemistry, often serving as a glycosyl donor in glycosylation reactions. The presence of the acetyl groups also provides stability against hydrolysis, allowing for controlled reactivity in various chemical processes. Additionally, this compound may exhibit biological activity, which can be explored in pharmacological studies. Overall, its structural characteristics make it a valuable compound in both synthetic and medicinal chemistry applications.
Formula:C21H26O11
InChI:InChI=1/C21H26O11/c1-11(22)27-10-17-18(28-12(2)23)19(29-13(3)24)20(30-14(4)25)21(32-17)31-16-8-6-15(26-5)7-9-16/h6-9,17-21H,10H2,1-5H3/t17-,18+,19+,20-,21-/m1/s1
Synonyms:- 4-Methoxyphenyl 2,3,4,6-Tetra-O-acetyl-β-D-galactopyranoside
- β-D-galactopyranoside, 4-methoxyphenyl, tetraacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methoxyphenyl 2,3,4,6-tetra-o-acetyl-β-d-galactopyranoside
CAS:Formula:C21H26O11Purity:98%Color and Shape:SolidMolecular weight:454.42454-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside
CAS:4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranosidePurity:>98%Color and Shape:SolidMolecular weight:454.42g/mol4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside
CAS:4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside is a white crystalline powder. It is soluble in water and ethanol. This chemical has been used as a reagent for the methylation of saccharides and oligosaccharides with 4-methoxybenzene sulfonate. It is also an excellent substrate for click chemistry reactions.Formula:C21H26O11Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:454.42 g/mol4-Methoxyphenyl 2,3,4,6-Tetra-O-acetyl-β-D-galactopyranoside
CAS:Formula:C21H26O11Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:454.43




