CAS 2872-72-2
:Phenyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside
Description:
Phenyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside is a glycoside derivative of galactose, characterized by the presence of four acetyl groups attached to the hydroxyl groups of the galactopyranose ring. This compound features a phenyl group, which enhances its solubility and reactivity in organic solvents. The acetylation of the hydroxyl groups not only protects these functional groups but also influences the compound's reactivity and stability. It is typically a white to off-white crystalline solid, and its molecular structure contributes to its applications in organic synthesis and carbohydrate chemistry. The compound is often used as a building block in the synthesis of more complex carbohydrates and can serve as a substrate in enzymatic reactions involving glycosidases. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions under which it is handled. As with many acetylated sugars, it may exhibit different biological activities, making it of interest in medicinal chemistry and biochemistry.
Formula:C20H24O10
InChI:InChI=1/C20H24O10/c1-11(21)25-10-16-17(26-12(2)22)18(27-13(3)23)19(28-14(4)24)20(30-16)29-15-8-6-5-7-9-15/h5-9,16-20H,10H2,1-4H3
InChI key:InChIKey=HPKPFIHCMIKXMU-LCWAXJCOSA-N
SMILES:O(C(C)=O)[C@@H]1[C@@H](OC(C)=O)[C@H](OC2=CC=CC=C2)O[C@H](COC(C)=O)[C@@H]1OC(C)=O
Synonyms:- Galactopyranoside, phenyl, tetraacetate, β-<span class="text-smallcaps">D</span>-
- NSC 173175
- Phenyl 2,3,4,6-tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-galactopyranoside
- Phenyl tetra-O-acetyl-beta-D-galactopyranoside
- Phenyl tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-galactopyranoside
- beta-D-Galactopyranoside, phenyl, tetraacetate
- phenyl 2,3,4,6-tetra-O-acetyl-beta-D-galactopyranoside
- phenyl 2,3,4,6-tetra-O-acetylhexopyranoside
- β-<span class="text-smallcaps">D</span>-Galactopyranoside, phenyl, 2,3,4,6-tetraacetate
- β-<span class="text-smallcaps">D</span>-Galactopyranoside, phenyl, tetraacetate
- β-D-Galactopyranoside, phenyl, 2,3,4,6-tetraacetate
- β-D-Galactopyranoside, phenyl, tetraacetate
- Galactopyranoside, phenyl, tetraacetate, β-D-
- Phenyl tetra-O-acetyl-β-D-galactopyranoside
- Phenyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside
- Phenyl 2-O,3-O,4-O,6-O-tetraacetyl-β-D-galactopyranoside
- PHENYL-2,3,4,6-TETRA-O-ACETYL-SS-D-GALACTOPYRANOSIDE
- 1-O-Phenyl-2-O,3-O,4-O,6-O-tetraacetyl-β-D-galactopyranose
- 1-O-Phenyl-β-D-galactopyranose 2,3,4,6-tetraacetate
- Phenyl-2,3,4,6-tetra-O-acetyl-b-D-galacto-pyranoside
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Phenyl-2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside
CAS:Controlled Product<p>Applications Phenyl-2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside (cas# 2872-72-2) is a compound useful in organic synthesis.<br></p>Formula:C20H24O10Color and Shape:NeatMolecular weight:424.4Phenyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside
CAS:<p>Phenyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside (TTA) is a synthetic monosaccharide that is used in the synthesis of complex carbohydrates. TTA is also known as Fluorination, Monosaccharide, Synthetic, Oligosaccharide, complex carbohydrate and has CAS No. 2872-72-2. TTA can be custom synthesized for research purposes or for commercial use and can be glycosylated to form polysaccharides. TTA is modified through methylation or click chemistry and can be used to modify sugar molecules or other carbohydrates. It is also high purity with less than 1% impurities.</p>Formula:C20H24O10Purity:Min. 95%Color and Shape:PowderMolecular weight:424.4 g/mol


