CAS 2873-90-7
:4-(Diethylamino)benzonitrile
Description:
4-(Diethylamino)benzonitrile, with the CAS number 2873-90-7, is an organic compound characterized by its structure, which features a benzonitrile moiety substituted with a diethylamino group at the para position. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its use in various applications, including as a dye intermediate and in the synthesis of other organic compounds. The presence of the diethylamino group imparts basic properties, making it a potential candidate for protonation in acidic environments. Additionally, the nitrile functional group contributes to its reactivity, allowing for further chemical transformations. 4-(Diethylamino)benzonitrile is generally soluble in organic solvents, and its physical properties, such as melting point and boiling point, can vary based on the specific formulation and purity. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C11H14N2
InChI:InChI=1S/C11H14N2/c1-3-13(4-2)11-7-5-10(9-12)6-8-11/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=KMLGFOAKCYHXCQ-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1=CC=C(C#N)C=C1
Synonyms:- 4-(Diethylamino)benzenecarbonitrile
- 4-(Diethylamino)benzenenitrile
- 4-(Diethylamino)benzonitrile
- 4-(N,N-Diethylamino)benzonitrile
- Benzonitrile, 4-(diethylamino)-
- Benzonitrile, p-(diethylamino)-
- N,N-Diethyl-p-cyanoaniline
- NSC 32450
- p-(Diethylamino)benzonitrile
- p-Cyano-N,N-diethylaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Diethylamino)benzonitrile
CAS:Formula:C11H14N2Purity:>98.0%(GC)(T)Color and Shape:White - Yellow Solid FormMolecular weight:174.25Benzonitrile, 4-(diethylamino)-
CAS:Formula:C11H14N2Purity:98%Color and Shape:SolidMolecular weight:174.24234-Diethylaminobenzonitrile
CAS:4-Diethylaminobenzonitrile is a molecule with the chemical formula C6H14N2. It is a colorless liquid that has an aromatic smell. It can be synthesized from acetonitrile and benzonitrile by UV irradiation. This compound has been used in cavity studies where it was found to have a large dipole moment, high exothermic reaction, and high emissions of uv radiation. The compound can also be used as an electrophotographic developer or in analytical chemistry to identify aromatic hydrocarbons. 4-Diethylaminobenzonitrile also has binding constants in hexane that are similar to benzene, which may be due to its resonance effect.Formula:C11H14N2Purity:Min. 95%Color and Shape:PowderMolecular weight:174.24 g/mol




