CAS 28732-79-8

4-Chloropyrido[2,3-d]pyrimidine

Description:

4-Chloropyrido[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings, with a chlorine substituent at the 4-position of the pyridine ring. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals and agrochemicals. The presence of the chlorine atom can influence its reactivity and biological activity, making it a subject of interest in drug discovery. 4-Chloropyrido[2,3-d]pyrimidine is soluble in organic solvents, and its chemical properties can be further explored through various analytical techniques such as NMR, IR spectroscopy, and mass spectrometry. Additionally, its molecular structure allows for potential interactions with biological targets, which is crucial for its evaluation in therapeutic contexts. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance.

Formula: C₇H₄ClN₃

InChI: InChI=1/C7H4ClN3/c8-6-5-2-1-3-9-7(5)11-4-10-6/h1-4H

SMILES: c1cc2c(Cl)ncnc2nc1

Synonyms:

• Pyrido[2,3-D]Pyrimidine, 4-Chloro-

Pyrido[2,3-d]pyrimidine, 4-chloro-

CAS: 28732-79-8

Formula: C₇H₄ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.5798

Ref: IN-DA002WAI

4-Chloropyrido[2,3-d]pyrimidine

CAS: 28732-79-8

4-Chloropyrido[2,3-d]pyrimidine

Purity: 97%

Molecular weight: 165.58g/mol

Ref: 54-OR922751

4-Chloropyrido[2,3-d]pyrimidine

CAS: 28732-79-8

Formula: C₇H₄ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.58

Ref: 10-F209407