CAS 28738-44-5
:[(3S,4R,5S,6R)-5-acetamido-3,4-diacetoxy-6-allyloxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,4R,5S,6R)-5-acetamido-3,4-diacetoxy-6-allyloxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 28738-44-5 is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetamido, diacetoxy, and allyloxy moieties, contributing to its reactivity and potential applications in organic synthesis or medicinal chemistry. The stereochemistry indicated by the (3S,4R,5S,6R) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's biological activity and interaction with other molecules. The presence of acetoxy groups may enhance its solubility and reactivity, while the allyloxy group can provide sites for further chemical modifications. Overall, this compound's unique structural features make it of interest for research in various fields, including pharmaceuticals and materials science, where its properties can be exploited for specific applications.
Formula:C17H25NO9
InChI:InChI=1/C17H25NO9/c1-6-7-23-17-14(18-9(2)19)16(26-12(5)22)15(25-11(4)21)13(27-17)8-24-10(3)20/h6,13-17H,1,7-8H2,2-5H3,(H,18,19)/t13?,14-,15+,16+,17+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
β-D-Glucopyranoside, 2-propen-1-yl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate
CAS:Formula:C17H25NO9Color and Shape:SolidMolecular weight:387.3817Allyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside
CAS:Allyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside is a synthetic glycoside that can be used as a building block for the synthesis of oligosaccharides and polysaccharides. It has been shown to have high purity and custom synthesis. This molecule is fluorinated at the 3 position and glycosylated at the 4 position. Allyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D--glucopyranoside is also methylated at the 6 position.Formula:C17H25NO9Purity:Min. 95%Molecular weight:387.39 g/mol


