CymitQuimica logo

CAS 287395-61-3

:

N-Methyl-N-pentyl-β-alanine

Description:
N-Methyl-N-pentyl-β-alanine is an amino acid derivative characterized by its unique structure, which includes a β-alanine backbone with a methyl group and a pentyl chain attached to the nitrogen atom. This compound is classified as a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. Its molecular structure contributes to its hydrophobic properties, making it less soluble in water compared to standard amino acids. N-Methyl-N-pentyl-β-alanine may exhibit interesting biological activities, potentially influencing neurotransmitter systems or acting as a modulator in various biochemical pathways. The presence of both a hydrophobic pentyl group and a polar amino group allows for diverse interactions in biological systems. Additionally, this compound may be of interest in pharmaceutical research and development due to its potential applications in drug design or as a biochemical probe. However, specific studies on its pharmacological effects and safety profile are necessary to fully understand its utility and implications in various fields.
Formula:C9H19NO2
InChI:InChI=1S/C9H19NO2/c1-3-4-5-7-10(2)8-6-9(11)12/h3-8H2,1-2H3,(H,11,12)
InChI key:InChIKey=YWSCUVIPKSJBRU-UHFFFAOYSA-N
SMILES:N(CCC(O)=O)(CCCCC)C
Synonyms:
  • N-Methyl-N-pentyl-β-alanine
  • 3-(Methylpropylamino)propanoic acid
  • β-Alanine, N-methyl-N-pentyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.