CAS 287397-89-1
:chloro-bis(1,1,2,2,2-pentadeuterioethoxy)-thioxo-$l^{5}-phosphane
Description:
Chloro-bis(1,1,2,2,2-pentadeuterioethoxy)-thioxo-$l^{5}-phosphane, with CAS number 287397-89-1, is a chemical compound characterized by its unique structure that includes a phosphorus atom bonded to a thioxo group and two ethoxy groups, each of which is fully deuterated. This deuteration enhances its stability and alters its physical properties compared to its non-deuterated counterparts. The presence of the thioxo group indicates that the phosphorus is in a specific oxidation state, contributing to its reactivity and potential applications in coordination chemistry. The chloro substituent suggests that the compound may participate in nucleophilic substitution reactions. Its unique isotopic labeling makes it valuable for studies in mechanistic chemistry and spectroscopy, allowing researchers to trace reaction pathways and interactions. Overall, this compound exemplifies the intersection of organophosphorus chemistry and isotopic labeling, making it a subject of interest in both synthetic and analytical chemistry.
Formula:C4D10ClO2PS
InChI:InChI=1/C4H10ClO2PS/c1-3-6-8(5,9)7-4-2/h3-4H2,1-2H3/i1D3,2D3,3D2,4D2
SMILES:C(C(OP(=S)(Cl)OC(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Diethyl Chlorothiophosphate-d10
CAS:Controlled ProductApplications Diethyl Chlorothiophosphate-d10 (cas# 287397-89-1) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C4D10ClO2PSColor and Shape:NeatMolecular weight:198.67Phosphorochloridothioic acid, O,O-di(ethyl-d5) ester (9CI)
CAS:Formula:C4ClD10O2PSColor and Shape:LiquidMolecular weight:198.6744

