CAS 2874-73-9

2,2-Dimethyldodecanoic acid

Description:

2,2-Dimethyldodecanoic acid, with the CAS number 2874-73-9, is a branched-chain fatty acid characterized by its long carbon chain and two methyl groups located at the second carbon position. This structural configuration contributes to its unique physical and chemical properties. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the temperature. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its branched structure affects its melting and boiling points, generally resulting in lower values compared to straight-chain fatty acids of similar carbon length. 2,2-Dimethyldodecanoic acid is used in various applications, including as a surfactant, lubricant, and in the synthesis of specialty chemicals. Additionally, it may exhibit antimicrobial properties, making it of interest in food preservation and other industries. Overall, its unique structure and properties make it a valuable compound in both industrial and research settings.

Formula: C₁₄H₂₈O₂

InChI: InChI=1S/C14H28O2/c1-4-5-6-7-8-9-10-11-12-14(2,3)13(15)16/h4-12H2,1-3H3,(H,15,16)

InChI key: InChIKey=DGMAZGHRQYFPHM-UHFFFAOYSA-N

SMILES: C(CCCCCCCCCC)(C(O)=O)(C)C

Synonyms:

• 2,2-Dimethyllauric acid
• Dodecanoic Acid, 2,2-Dimethyl-
• α,α-Dimethyllauric acid
• 2,2-Dimethyldodecanoic acid
• 2,2-DIMETHYLDODECANOIC ACID

2,2-Dimethyldodecanoic acid

CAS: 2874-73-9

2,2-Dimethyldodecanoic acid is a fatty acid ester that is prepared by the reaction of malonic acid with a fatty acid. It has been used as a lubricant and in the production of liquid crystals. 2,2-Dimethyldodecanoic acid has been shown to have efficient methods for biomolecular labeling and immobilization. This compound also exhibits amide-like properties and has functional groups such as hydroxyl, carboxylic acid, and aliphatic chains. The structure of 2,2-Dimethyldodecanoic acid is constant throughout its transformation from an acidic form to a more neutral form. Slow release may be achieved through this process because the molecule maintains its shape after being converted into a neutral state.

Formula: C₁₄H₂₈O₂

Purity: Min. 95%

Molecular weight: 228.37 g/mol

Ref: 3D-CAA87473