CAS 28741-08-4
:B-Octylboronic acid
Description:
B-Octylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to an octyl chain. It typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. This compound is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and materials science. B-Octylboronic acid is soluble in organic solvents such as ethanol and dichloromethane, but it has limited solubility in water due to its hydrophobic octyl chain. Its reactivity is influenced by the boron atom, which can participate in cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, it may exhibit properties that allow it to act as a ligand in coordination chemistry. Safety precautions should be taken when handling this compound, as boronic acids can be irritants and may pose environmental hazards.
Formula:C8H19BO2
InChI:InChI=1S/C8H19BO2/c1-2-3-4-5-6-7-8-9(10)11/h10-11H,2-8H2,1H3
InChI key:InChIKey=GKFRVXOKPXCXAK-UHFFFAOYSA-N
SMILES:C(CCCCC)CCB(O)O
Synonyms:- 1-Octaneboronic acid
- 1-Octylboronic acid
- B-Octylboronic acid
- Boronic acid, B-octyl-
- Boronic acid, octyl-
- Caprylboronic acid
- Octylboronic Acid
- n-Octaneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
n-Octylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H19BO2Color and Shape:White to Almost white powder to crystalMolecular weight:158.051-Octylboronic acid, 97%
CAS:1-Octylboronic acid is used as an organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKFormula:C8H19BO2Purity:97%Color and Shape:Crystals or powder or crystalline powder, White to pale creamMolecular weight:158.05





