CAS 28746-99-8

1'-hydroxy-1,1'-bi(cyclohexyl)-2-one

Description:

1'-Hydroxy-1,1'-bi(cyclohexyl)-2-one, with the CAS number 28746-99-8, is an organic compound characterized by its unique structure, which features a hydroxyl group and a diketone functionality. This compound is part of the larger family of biaryl compounds, where two cyclohexyl groups are connected through a carbonyl group. It typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl and carbonyl groups. The compound may participate in various chemical reactions, including oxidation and condensation, making it of interest in synthetic organic chemistry. Its physical properties, such as melting point and boiling point, can vary based on purity and specific conditions. Additionally, the compound's applications may extend to fields like materials science and pharmaceuticals, where its structural characteristics can influence the behavior and efficacy of formulations. Safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₁₂H₂₀O₂

InChI: InChI=1/C12H20O2/c13-11-7-3-2-6-10(11)12(14)8-4-1-5-9-12/h10,14H,1-9H2

SMILES: C1CCC(CC1)(C1CCCCC1=O)O

Synonyms:

• [1,1'-Bicyclohexyl]-2-One, 1'-Hydroxy-
• 1'-Hydroxy-1,1'-bi(cyclohexyl)-2-one
• 1'-hydroxybi(cyclohexan)-2-one
• 1'-Hydroxy-[1,1'-bi(cyclohexan)]-2-one
• 2-(1-hydroxycyclohexyl)cyclohexanone
• 2-(1-hydroxycyclohexyl)cyclohexan-1-one

[1,1'-Bicyclohexyl]-2-one, 1'-hydroxy-

CAS: 28746-99-8

Formula: C₁₂H₂₀O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.2860

Ref: IN-DA002WC3

1'-Hydroxy-[1,1'-bi(cyclohexan)]-2-one

CAS: 28746-99-8

1'-Hydroxy-[1,1'-bi(cyclohexan)]-2-one

Purity: 95%

Molecular weight: 196.29g/mol

Ref: 54-OR1072345

1′-Hydroxy-[1,1′-bi(cyclohexan)]-2-one

CAS: 28746-99-8

Formula: C₁₂H₂₀O₂

Purity: 95%

Molecular weight: 196.29

Ref: 10-F215564