CAS 28769-06-4
:2-(4-chlorophenoxy)ethanamine
Description:
2-(4-Chlorophenoxy)ethanamine, with the CAS number 28769-06-4, is an organic compound characterized by its amine functional group and a chlorophenoxy moiety. It features a two-carbon ethyl chain connecting an amino group (-NH2) to a 4-chlorophenoxy group, which consists of a phenol ring substituted with a chlorine atom at the para position. This compound is typically a colorless to light yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents such as water and alcohols, which is indicative of its ability to engage in hydrogen bonding due to the presence of the amino group. The chlorophenoxy structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the presence of the chlorine atom may influence its biological activity and reactivity, making it a subject of interest in medicinal chemistry and material science. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H10ClNO
InChI:InChI=1/C8H10ClNO/c9-7-1-3-8(4-2-7)11-6-5-10/h1-4H,5-6,10H2
SMILES:c1cc(ccc1Cl)OCCN
Synonyms:- Ethanamine, 2-(4-chlorophenoxy)-
- 2-(4-Chlorophenoxy)Ethanaminium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(4-Chlorophenoxy)ethanamine
CAS:Formula:C8H10ClNOPurity:97%Color and Shape:SolidMolecular weight:171.62412-(4-Chlorophenoxy)ethylamine
CAS:2-(4-Chlorophenoxy)ethylaminePurity:≥95%Molecular weight:171.62g/mol[2-(4-Chlorophenoxy)ethyl]amine hydrochloride
CAS:2-(4-Chlorophenoxy)ethyl]amine hydrochloride is a chemical that can be used as a building block for the synthesis of pharmaceuticals. It is an intermediate in the production of fine chemicals and other reagents. 2-[2-(4-Chlorophenoxy)ethoxy]ethylamine hydrochloride has CAS number 28769-06-4 and can be used for research purposes.Formula:C8H10ClNOPurity:Min. 95 Area-%Color and Shape:Clear LiquidMolecular weight:171.62 g/mol2-(4-Chlorophenoxy)ethylamine
CAS:Formula:C8H10ClNOPurity:>97%Color and Shape:LiquidMolecular weight:171.62



