CAS 2877-24-9
:Trimethylpropylammonium chloride
Description:
Trimethylpropylammonium chloride, with the CAS number 2877-24-9, is a quaternary ammonium salt characterized by its cationic nature. It consists of a trimethylammonium group attached to a propyl chain, making it a surfactant and a potential phase transfer catalyst. This compound is typically a white crystalline solid or a viscous liquid, depending on its purity and temperature. It is soluble in water and various organic solvents, which enhances its utility in diverse applications, including as a surfactant in detergents and emulsifiers. Trimethylpropylammonium chloride exhibits antimicrobial properties, making it useful in disinfectants and preservatives. Additionally, it can interact with biological membranes, which may influence its behavior in biological systems. Safety data indicates that it should be handled with care, as it can be irritating to skin and eyes. Overall, its unique structure and properties make it valuable in both industrial and laboratory settings.
Formula:C6H16N·Cl
InChI:InChI=1S/C6H16N.ClH/c1-5-6-7(2,3)4;/h5-6H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=NRWCNEBHECBWRJ-UHFFFAOYSA-M
SMILES:C([N+](C)(C)C)CC.[Cl-]
Synonyms:- 1-Propanaminium, N,N,N-trimethyl-, chloride (1:1)
- 1-Propanaminium, N,N,N-trimethyl-, chloride
- Trimethylpropylammonium chloride
- Ammonium, trimethylpropyl-, chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Trimethylpropylammonium Chloride
CAS:Controlled ProductFormula:C6H16N·ClColor and Shape:NeatMolecular weight:137.651

