CAS 287717-44-6
:(1R,4S)-4-Aminocyclopentene-1-methanol hydrochloride
Description:
(1R,4S)-4-Aminocyclopentene-1-methanol hydrochloride is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopentene ring with an amino group and a hydroxymethyl group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The specific stereochemistry indicated by the (1R,4S) configuration suggests that it has distinct spatial arrangements that can influence its biological activity and reactivity. As an amino alcohol, it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The compound's properties make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, where its structural features could contribute to specific interactions with biological targets. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C6H12ClNO
InChI:InChI=1/C6H11NO.ClH/c7-6-2-1-5(3-6)4-8;/h1,6,8H,2-4,7H2;1H/t6-;/m0./s1
SMILES:C1=C(C[C@H](C1)N)CO.Cl
Synonyms:- [(1R,4S)-4-Aminocyclopent-2-enyl]methanol hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
((1R,4S)-4-Aminocyclopent-2-en-1-yl)methanol hydrochloride
CAS:Formula:C6H12ClNOColor and Shape:SolidMolecular weight:149.6186[(1R,4S)-4-Aminocyclopent-2-en-1-yl]methanol hydrochloride
CAS:[(1R,4S)-4-Aminocyclopent-2-en-1-yl]methanol hydrochloridePurity:95%Molecular weight:149.62g/mol(1R,4S)-4-Amino-2-cyclopentene-1-methanol hydrochloride
CAS:(1R,4S)-4-Amino-2-cyclopentene-1-methanol hydrochloride is a chemical compound that is used as a building block in the synthesis of other compounds. It is also known to be a speciality chemical and a research chemical. (1R,4S)-4-Amino-2-cyclopentene-1-methanol hydrochloride can be used as an intermediate in the production of fine chemicals, pharmaceuticals and agrochemicals. The compound has been found to have high quality and good purity by the manufacturer.Formula:C6H11NO•HClPurity:Min. 95%Color and Shape:Brown SolidMolecular weight:149.62 g/mol



