CAS 28781-92-2
:tetramethyl propane-1,1,3,3-tetracarboxylate
Description:
Tetramethyl propane-1,1,3,3-tetracarboxylate, with the CAS number 28781-92-2, is an organic compound characterized by its structure, which includes a central tetramethyl propane backbone with four carboxylate functional groups. This compound is typically a colorless to pale yellow liquid, exhibiting low volatility and a relatively high boiling point due to the presence of multiple carboxylate groups that enhance intermolecular interactions. It is soluble in polar solvents, such as water and alcohols, owing to its polar carboxylate groups. The compound is often used in organic synthesis and as a building block in the preparation of various chemical derivatives. Its reactivity is influenced by the carboxylate groups, which can participate in esterification and other chemical reactions. Safety data indicates that, like many carboxylate esters, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Proper storage conditions are essential to maintain its stability and prevent degradation.
Formula:C11H16O8
InChI:InChI=1/C11H16O8/c1-16-8(12)6(9(13)17-2)5-7(10(14)18-3)11(15)19-4/h6-7H,5H2,1-4H3
SMILES:COC(=O)C(CC(C(=O)OC)C(=O)OC)C(=O)OC
Synonyms:- 1,1,3,3-Propanetetracarboxylic Acid, Tetramethyl Ester
- Tetramethyl propane-1,1,3,3-tetracarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pentanetetracarboxylic acid, 1,2,4,5-tetramethyl ester
CAS:Formula:C11H16O8Purity:95%Color and Shape:SolidMolecular weight:276.23991,1,3,3-Tetramethyl propane-1,1,3,3-tetracarboxylate
CAS:1,1,3,3-Tetramethyl propane-1,1,3,3-tetracarboxylatePurity:95%Molecular weight:276.24g/mol1,1,3,3-Tetramethyl propane-1,1,3,3-tetracarboxylate
CAS:<p>1,1,3,3-Tetramethyl propane-1,1,3,3-tetracarboxylate is a hexamethyl triamide that is used as a catalyst in the production of tetramethyl. The three methyl groups on the molecule serve as Lewis acid sites and are involved in the reaction mechanism. It is produced by electrolysis of methyl acetate with a nickel anode and a copper cathode in an acid solution.</p>Formula:C11H16O8Purity:Min. 95%Molecular weight:276.24 g/mol



