CAS 28783-38-2
:4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium chloride
Description:
4,5,6,7-Tetrahydrothieno[2,3-c]pyridin-6-ium chloride is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a thieno and a pyridine moiety. This compound features a saturated tetrahydro framework, contributing to its stability and solubility in polar solvents. The presence of a quaternary ammonium ion (the pyridinium part) imparts cationic properties, making it soluble in water and other polar solvents. It is typically encountered as a chloride salt, which enhances its ionic character. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structural features suggest potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and solubility characteristics may facilitate its use in various chemical reactions or applications in organic synthesis. As with many heterocycles, it may also display interesting electronic properties due to the conjugation within its ring system.
Formula:C7H10ClNS
InChI:InChI=1/C7H9NS.ClH/c1-3-8-5-7-6(1)2-4-9-7;/h2,4,8H,1,3,5H2;1H
SMILES:C1CNCc2c1ccs2.Cl
Synonyms:- 4,5,6,7-Tetrahydrothieno[2,3-c]pyridine hydrochloride (1:1)
- 4,5,6,7-Tetrahydrothieno[2,3-c]pyridinhydrochlorid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,5,6,7-Tetrahydrothieno[2,3-c]pyridine, HCl
CAS:Formula:C7H10ClNSPurity:96%Color and Shape:SolidMolecular weight:175.6790Ref: IN-DA002WFM
1g73.00€5g161.00€10g299.00€1kgTo inquire25gTo inquire250gTo inquire500gTo inquire100mg33.00€250mg50.00€4,5,6,7-Tetrahydrothieno[2,3-c]pyridine hydrochloride
CAS:4,5,6,7-Tetrahydrothieno[2,3-c]pyridine hydrochloridePurity:98%Molecular weight:175.684g/mol4,5,6,7-Tetrahydrothieno[2,3-c]pyridine Hydrochloride
CAS:Controlled ProductApplications Used for preparation of thieno-tetrahydropyridines useful as class III antiarrhythmic agents.
References Bahekar, R., et al.: Bioorg. Med. Chem., 15, 5950 (2007), Hayakawa, M., et al.: Bioorg. Med. Chem. Lett., 17, 2438 (2007),Formula:C7H10ClNSColor and Shape:NeatMolecular weight:175.684,5,6,7-Tetrahydrothieno[2,3-c]pyridine hydrochloride
CAS:Formula:C7H10ClNSPurity:96%Color and Shape:White powderMolecular weight:175.67



