CymitQuimica logo

CAS 28784-39-6

:

ethylmethylbenzothiazolylidenemethylbuten-ylsulfo

Description:
Ethylmethylbenzothiazolylidenemethylbuten-ylsulfo, identified by its CAS number 28784-39-6, is a chemical compound that belongs to the class of benzothiazole derivatives. This compound typically exhibits characteristics such as a complex molecular structure, which includes multiple functional groups that contribute to its chemical reactivity and potential applications. It may possess properties such as solubility in organic solvents, and its stability can vary depending on environmental conditions. The presence of sulfonyl groups often enhances its polarity, making it useful in various chemical processes. Compounds like this are often studied for their potential applications in fields such as materials science, pharmaceuticals, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with certain benzothiazole derivatives. As with any chemical, it is crucial to consult safety data sheets and relevant literature for detailed information regarding its properties and applications.
Formula:C29H30N2O3S3
InChI:InChI=1/C29H30N2O3S3/c1-4-21(18-27-30(5-2)24-17-20(3)11-13-25(24)35-27)19-28-31(15-8-16-37(32,33)34)29-23-10-7-6-9-22(23)12-14-26(29)36-28/h6-7,9-14,17-19H,4-5,8,15-16H2,1-3H3
SMILES:CCC(=Cc1[n+](CC)c2cc(C)ccc2s1)C=c1n(CCC[S-](=O)(=O)=O)c2c3ccccc3ccc2s1
Synonyms:
  • 2-{2-[(3-Ethyl-5-methyl-2(3H)-benzothiazolylidene)methyl]-1-butenyl}-1-(3-sulfopropyl)naphtho[1,2-d]thiazolium hydroxide inner salt
  • 3-(2-{2-[(3-ethyl-5-methyl-1,3-benzothiazol-2(3H)-ylidene)methyl]but-1-en-1-yl}naphtho[1,2-d][1,3]thiazol-1-ium-1-yl)propane-1-sulfonate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.