CAS 28788-62-7
:4-Butylbenzoyl chloride
Description:
4-Butylbenzoyl chloride, with the CAS number 28788-62-7, is an organic compound characterized by its aromatic structure, featuring a butyl group attached to a benzoyl chloride moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis. It is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water. The compound is sensitive to moisture and can hydrolyze to form the corresponding carboxylic acid and hydrochloric acid upon exposure to water. 4-Butylbenzoyl chloride is often utilized in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals, due to its ability to participate in acylation reactions. As with many acyl chlorides, it should be handled with care, as it can be corrosive and irritating to the skin and respiratory system. Proper safety precautions, including the use of personal protective equipment, are essential when working with this substance.
Formula:C11H13ClO
InChI:InChI=1S/C11H13ClO/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8H,2-4H2,1H3
InChI key:InChIKey=OUOWCSJYDCPVDM-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=CC=C(CCCC)C=C1
Synonyms:- 4-n-Butylbenzoyl chloride
- Benzoyl chloride, 4-butyl-
- Benzoyl chloride, p-butyl-
- p-Butylbenzoyl chloride
- p-n-Butylbenzoyl chloride
- 4-Butylbenzoyl chloride
- 4-Butylbenzoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-n-Butylbenzoyl chloride, 98%
CAS:4-Butylbenzoyl chloride was used in the synthesis of 2,5-bis[(4-butylbenzoyl)oxy]styrene (BBOS, monomer). This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original AlfaFormula:C11H13ClOPurity:98%Color and Shape:Clear colorless, LiquidMolecular weight:196.67Benzoyl chloride, 4-butyl-
CAS:Formula:C11H13ClOPurity:98%Color and Shape:LiquidMolecular weight:196.6733Ref: IN-DA002WGE
5g25.00€10g41.00€15g56.00€25g66.00€50g98.00€75g115.00€100g150.00€200g202.00€300g297.00€400g523.00€500g582.00€4-(But-1-yl)benzoyl chloride
CAS:4-(But-1-yl)benzoyl chlorideFormula:C11H13ClOPurity:98%Color and Shape: clear. faint beige liquidMolecular weight:196.67g/mol



