CAS 28789-35-7: Nordihydrocapsaicin
Description:Nordihydrocapsaicin is a chemical compound classified as a capsaicinoid, which is a group of compounds responsible for the heat in chili peppers. It is a colorless to pale yellow oil that is soluble in organic solvents but has limited solubility in water. Nordihydrocapsaicin is known for its pungent flavor and is often studied for its potential health benefits, including analgesic and anti-inflammatory properties. The compound interacts with the TRPV1 receptor, which is involved in the sensation of heat and pain, making it of interest in pain management research. Its molecular structure features a long hydrocarbon chain with an amide functional group, contributing to its biological activity. Additionally, it is often used in various applications, including food flavoring and topical analgesics. Safety data indicates that while it can cause irritation upon contact, it is generally considered safe when used appropriately. Overall, nordihydrocapsaicin is a significant compound in both culinary and medicinal contexts.
Formula:C17H27NO3
InChI:InChI=1S/C17H27NO3/c1-13(2)7-5-4-6-8-17(20)18-12-14-9-10-15(19)16(11-14)21-3/h9-11,13,19H,4-8,12H2,1-3H3,(H,18,20)
InChI key:InChIKey=VQEONGKQWIFHMN-UHFFFAOYSA-N
SMILES:O=C(NCC1=CC=C(O)C(OC)=C1)CCCCCC(C)C
- Synonyms:
- N-(4-Hydroxy-3-methoxybenzyl)-7-methyloctanamid
- N-[(4-Hydroxy-3-methoxyphenyl)methyl]-7-methyloctanamide
- Nordihydrocapsaicin
- Norhydrocapsaicin
- Octanamide, 7-methyl-N-vanillyl-
- octanamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-7-methyl-
- N-(4-Hydroxy-3-méthoxybenzyl)-7-méthyloctanamide
- N-(4-Hydroxy-3-methoxybenzyl)-7-methyloctanamide
![Octanamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-7-methyl-](https://static.cymitquimica.com/products/IN/thumb/DA002WGB.jpg)
