CAS 2879-15-4
:3,9-Dihydro-1,3-dimethyl-8-(phenylmethyl)-1H-purine-2,6-dione
Description:
3,9-Dihydro-1,3-dimethyl-8-(phenylmethyl)-1H-purine-2,6-dione, with the CAS number 2879-15-4, is a purine derivative that exhibits a complex structure characterized by a fused bicyclic ring system. This compound features two methyl groups at the 1 and 3 positions, contributing to its lipophilicity and potential biological activity. The presence of a phenylmethyl group at the 8 position enhances its structural diversity and may influence its interaction with biological targets. As a purine analog, it may exhibit properties similar to nucleobases, potentially interacting with nucleic acids or enzymes involved in cellular processes. The compound is of interest in medicinal chemistry due to its potential pharmacological applications, including anti-inflammatory or anti-cancer activities. Its solubility, stability, and reactivity can vary based on environmental conditions, making it important to consider these factors in experimental settings. Overall, 3,9-Dihydro-1,3-dimethyl-8-(phenylmethyl)-1H-purine-2,6-dione represents a significant compound for further research in drug development and biochemical studies.
Formula:C14H14N4O2
InChI:InChI=1S/C14H14N4O2/c1-17-12-11(13(19)18(2)14(17)20)15-10(16-12)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,15,16)
InChI key:InChIKey=SWKGFZTXWQMFLK-UHFFFAOYSA-N
SMILES:O=C1C2=C(N(C)C(=O)N1C)N=C(CC3=CC=CC=C3)N2
Synonyms:- 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl-8-(phenylmethyl)-
- 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl-8-(phenylmethyl)-
- 3,9-Dihydro-1,3-dimethyl-8-(phenylmethyl)-1H-purine-2,6-dione
- 8-Benzyl Theophylline
- 8-Benzyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione
- 8-Benzyltheophyline
- 8-benzyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
- Nsc 14131
- Theophylline, 8-benzyl-
- 8-Benzyltheophylline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl-8-(phenylmethyl)-
CAS:Formula:C14H14N4O2Purity:98.0%Color and Shape:SolidMolecular weight:270.28668-Benzyl Theophylline
CAS:Formula:C14H14N4O2Color and Shape:White To Off-White SolidMolecular weight:270.298-Benzyltheophylline
CAS:Formula:C14H14N4O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:270.298-Benzyltheophylline
CAS:Controlled ProductFormula:C14H14N4O2Color and Shape:NeatMolecular weight:270.298-Benzyltheophylline
CAS:Controlled Product8-Benzyltheophylline is a hybrid molecule that consists of theophylline, a methylxanthine, and benzyl groups. It has pharmacological properties in rat brain membranes, where it acts as an adenosine receptor antagonist. 8-Benzyltheophylline has also been shown to be hypotensive in vivo and in vitro. It may act by inhibiting the sodium carbonate-induced release of calcium ions from intracellular stores or by binding to calcium channels. This drug is synthesized from theophylline and sodium carbonate, which are nucleophilic molecules that can undergo a substitution reaction with each other.
Formula:C14H14N4O2Purity:Min. 95%Molecular weight:270.29 g/mol






