CAS 2879-20-1: 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethanone
Description:1-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethanone, with the CAS number 2879-20-1, is an organic compound characterized by its unique bicyclic structure that incorporates a benzodioxin moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. Typically, compounds of this nature exhibit moderate polarity due to the presence of both aromatic and aliphatic components, influencing their solubility in various organic solvents. The bicyclic structure may also impart specific stereochemical properties, affecting its interactions in biological systems. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethanone represents a versatile scaffold for further chemical modifications and potential applications in drug development and material science.
Formula:C10H10O3
InChI:InChI=1S/C10H10O3/c1-7(11)8-2-3-9-10(6-8)13-5-4-12-9/h2-3,6H,4-5H2,1H3
InChI key:InChIKey=HGVWMTAIIYNQSI-UHFFFAOYSA-N
SMILES:O=C(C1=CC=C2OCCOC2=C1)C
- Synonyms:
- 1,4-Benzodioxin, ethanone deriv.
- 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethan-1-one
- 1-(2,3-Dihydrobenzo[1,4]dioxin-6-yl)ethanone
- 1-(Benzodioxan-6-yl)ethanone
- 3,4-Ethylenedioxyacetophenone
- 6-Acetyl-1,4-benzodioxan
- 6-Acetyl-1,4-benzodioxane
- 6-Acetyl-2,3-dihydro-1,4-benzodioxin
- 6-Acetylbenzodioxane
- Ethanone, 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-
- See more synonyms
- Ketone, 1,4-benzodioxan-6-yl methyl
- 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethanone
