CAS 2879-42-7

3-Chloro-2,5,6-trifluoropyridine

Description:

3-Chloro-2,5,6-trifluoropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with three fluorine atoms and one chlorine atom. The presence of these halogen substituents significantly influences its chemical properties, making it a polar compound with potential applications in pharmaceuticals and agrochemicals. The trifluoromethyl groups enhance its reactivity and stability, while the chlorine atom can participate in various chemical reactions, such as nucleophilic substitutions. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and has a relatively low boiling point. Its solubility in polar solvents is notable, which is attributed to the electronegative nature of the fluorine and chlorine atoms. Additionally, 3-Chloro-2,5,6-trifluoropyridine can serve as an important intermediate in the synthesis of more complex organic molecules, particularly in the development of agrochemicals and pharmaceuticals, due to its ability to undergo various chemical transformations. Safety precautions should be observed when handling this compound, as it may pose health risks.

Formula: C₅HClF₃N

InChI: InChI=1/C5HClF3N/c6-2-1-3(7)5(9)10-4(2)8/h1H

SMILES: c1c(c(F)nc(c1F)F)Cl

3-Chloro-2,5,6-trifluoropyridine, 98+%

CAS: 2879-42-7

3-Chloro-2,5,6-trifluoropyridine is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SK

Formula: C₅HClF₃N

Purity: 98+%

Color and Shape: Clear colorless, Liquid

Molecular weight: 167.52

Ref: 02-L19543

Pyridine, 3-chloro-2,5,6-trifluoro-

CAS: 2879-42-7

Formula: C₅HClF₃N

Purity: 98%

Color and Shape: Liquid

Molecular weight: 167.5163

Ref: IN-DA002WHL

3-Chloro-2,5,6-trifluoropyridine

CAS: 2879-42-7

3-Chloro-2,5,6-trifluoropyridine

Formula: C₅HClF₃N

Purity: 98%

Color and Shape: clear. colourless liquid

Molecular weight: 167.52g/mol

Ref: 54-PC10520

3-Chloro-2,5,6-trifluoropyridine

CAS: 2879-42-7

Formula: C₅HClF₃N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 167.52

Ref: 10-F233681