CAS 2879-83-6

N-(4-bromophenyl)benzamide

Description:

N-(4-bromophenyl)benzamide, with the CAS number 2879-83-6, is an organic compound characterized by its amide functional group and aromatic structure. It features a benzamide core, where a bromophenyl group is substituted at the nitrogen atom of the amide. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but may have limited solubility in water due to its hydrophobic aromatic rings. The presence of the bromine atom introduces both steric and electronic effects, which can influence its reactivity and interactions in chemical reactions. N-(4-bromophenyl)benzamide may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point and boiling point, can vary based on purity and specific conditions. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₃H₁₀BrNO

InChI: InChI=1/C13H10BrNO/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10/h1-9H,(H,15,16)

SMILES: c1ccc(cc1)C(=O)Nc1ccc(cc1)Br

Synonyms:

• benzamide, N-(4-bromophenyl)-

Benzenemethanamine, N-(4-bromophenyl)-

CAS: 2879-83-6

Formula: C₁₃H₁₂BrN

Purity: 95.0%

Molecular weight: 262.1451

Ref: IN-DA002WHF

N-Benzyl-4-bromoaniline

CAS: 2879-83-6

N-Benzyl-4-bromoaniline

Formula: C₁₃H₁₂BrN

Purity: ≥95%

Color and Shape: white to orange solid

Molecular weight: 262.15g/mol

Ref: 54-OR310080