CymitQuimica logo

CAS 287917-97-9

:

4-bromo-1H-pyrazole-5-carbaldehyde

Description:
4-Bromo-1H-pyrazole-5-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a bromine atom at the 4-position and an aldehyde functional group at the 5-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its role in various chemical reactions, including nucleophilic additions and condensation reactions. Its unique structure allows it to participate in the formation of more complex molecules, making it valuable in medicinal chemistry and material science. Additionally, the compound's properties, such as solubility and stability, can vary based on the solvent and environmental conditions. As with many brominated compounds, it may exhibit biological activity, warranting further investigation for potential pharmaceutical applications. Safety precautions should be observed when handling this compound due to its reactive nature and potential toxicity.
Formula:C4H3BrN2O
InChI:InChI=1/C4H3BrN2O/c5-3-1-6-7-4(3)2-8/h1-2H,(H,6,7)
InChI key:UWGFONONBAIDAF-UHFFFAOYSA-N
SMILES:c1c(c(C=O)n[nH]1)Br
Found 6 products.