CAS 287944-16-5
:3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester
Description:
3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester is an organic compound characterized by its boronic acid functionality, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a dihydropyran ring, contributing to its cyclic structure and potential reactivity. The pinacol ester moiety enhances its stability and solubility, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The presence of the boronic acid group allows for participation in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is valuable in the formation of carbon-carbon bonds. Additionally, the compound may exhibit unique properties such as selectivity in reactions and potential applications in drug development due to its ability to interact with biological molecules. Overall, 3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester is a versatile building block in organic chemistry with significant implications in both research and industrial applications.
Formula:C11H19BO3
InChI:InChI=1/C11H19BO3/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9/h5H,6-8H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(C2=CCOCC2)O1
Synonyms:- 2H-Pyran, 3,6-dihydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyran
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyran
CAS:Formula:C11H19BO3Purity:>98.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:210.083,6-Dihydro-2H-pyran-4-boronic acid pinacol ester, 98%
CAS:It plays an important role as intermediate for organic synthesis agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The origin
Formula:C11H19BO3Purity:98%Molecular weight:210.083,6-Dihydro-2H-pyran-4-boronic acid pinacol ester
CAS:Formula:C11H19BO3Purity:98%Color and Shape:SolidMolecular weight:210.07783,6-Dihydro-2H-pyran-4-boronic acid, pinacol ester
CAS:3,6-Dihydro-2H-pyran-4-boronic acid, pinacol esterPurity:98%Color and Shape:SolidMolecular weight:210.08g/mol3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester
CAS:Formula:C11H19BO3Purity:98%Color and Shape:SolidMolecular weight:210.08




