CymitQuimica logo

CAS 2881-85-8

:

3-phenylpyrazine-2-carboxylic acid

Description:
3-Phenylpyrazine-2-carboxylic acid is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a phenyl group at the 3-position and a carboxylic acid functional group at the 2-position contributes to its chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. It may also display acidic behavior, allowing it to participate in various chemical reactions, such as esterification or amidation. The compound is of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing more complex molecules. Additionally, its structural features may influence its reactivity and interactions with other chemical entities. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C11H8N2O2
InChI:InChI=1/C11H8N2O2/c14-11(15)10-9(12-6-7-13-10)8-4-2-1-3-5-8/h1-7H,(H,14,15)
InChI key:DQLZTJMUULVRNZ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1c(C(=O)O)nccn1
Found 3 products.